C23H28Cl2N2O4 — CID 59932494
[2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate (PubChem CID 59932494) has the molecular formula C23H28Cl2N2O4 and a molecular weight of 467.39 g/mol. Its IUPAC name is [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate.
| Compound Name | [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 59932494 |
| Molecular Formula | C23H28Cl2N2O4 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate |
| SMILES | CNCCCCOc1c(Cl)cc(C(=O)N[C@H](C)Cc2ccccc2)c(OC(C)=O)c1Cl |
| InChI | InChI=1S/C23H28Cl2N2O4/c1-15(13-17-9-5-4-6-10-17)27-23(29)18-14-19(24)22(30-12-8-7-11-26-3)20(25)21(18)31-16(2)28/h4-6,9-10,14-15,26H,7-8,11-13H2,1-3H3,(H,27,29)/t15-/m1/s1 |
| InChIKey | MNHXXGZMBWWISO-OAHLLOKOSA-N |
| XLogP | 4.66 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|