About [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate
[2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate (PubChem CID 59932494) has the molecular formula C23H28Cl2N2O4
and a molecular weight of 467.39 g/mol. Its IUPAC name is [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate.
Molecular Properties
| Compound Name | [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate |
| PubChem CID | 59932494 |
| Molecular Formula | C23H28Cl2N2O4 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate |
| SMILES | CNCCCCOc1c(Cl)cc(C(=O)N[C@H](C)Cc2ccccc2)c(OC(C)=O)c1Cl |
| InChI | InChI=1S/C23H28Cl2N2O4/c1-15(13-17-9-5-4-6-10-17)27-23(29)18-14-19(24)22(30-12-8-7-11-26-3)20(25)21(18)31-16(2)28/h4-6,9-10,14-15,26H,7-8,11-13H2,1-3H3,(H,27,29)/t15-/m1/s1 |
| InChIKey | MNHXXGZMBWWISO-OAHLLOKOSA-N |
| XLogP | 4.66 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate?
The IUPAC name of [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate (CID 59932494) is [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate.
What is the SMILES notation for [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate?
The canonical SMILES for [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate is CNCCCCOc1c(Cl)cc(C(=O)N[C@H](C)Cc2ccccc2)c(OC(C)=O)c1Cl.
What is the InChIKey of [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate?
The InChIKey is MNHXXGZMBWWISO-OAHLLOKOSA-N. The full InChI is InChI=1S/C23H28Cl2N2O4/c1-15(13-17-9-5-4-6-10-17)27-23(29)18-14-19(24)22(30-12-8-7-11-26-3)20(25)21(18)31-16(2)28/h4-6,9-10,14-15,26H,7-8,11-13H2,1-3H3,(H,27,29)/t15-/m1/s1.
What are the key properties of [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate?
[2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate has a molecular weight of 467.39 g/mol, XLogP of 4.66, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dichloro-3-[4-(methylamino)butoxy]-6-[[(2R)-1-phenylpropan-2-yl]carbamoyl]phenyl] acetate is sourced from PubChem (CID 59932494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).