C28H30Cl2N2O5 — CID 22094813
benzyl 2-[[3,5-dichloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoate (PubChem CID 22094813) has the molecular formula C28H30Cl2N2O5 and a molecular weight of 545.46 g/mol. Its IUPAC name is benzyl 2-[[3,5-dichloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoate.
| Compound Name | benzyl 2-[[3,5-dichloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 22094813 |
| Molecular Formula | C28H30Cl2N2O5 |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | benzyl 2-[[3,5-dichloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoate |
| SMILES | CNCCCCOc1c(Cl)cc(C(=O)NC(Cc2ccccc2)C(=O)OCc2ccccc2)c(O)c1Cl |
| InChI | InChI=1S/C28H30Cl2N2O5/c1-31-14-8-9-15-36-26-22(29)17-21(25(33)24(26)30)27(34)32-23(16-19-10-4-2-5-11-19)28(35)37-18-20-12-6-3-7-13-20/h2-7,10-13,17,23,31,33H,8-9,14-16,18H2,1H3,(H,32,34) |
| InChIKey | WVZLULKEQSARGB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|