C23H29ClN2O5 — CID 59901914
ethyl (2R)-2-[[3-chloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoate (PubChem CID 59901914) has the molecular formula C23H29ClN2O5 and a molecular weight of 448.95 g/mol. Its IUPAC name is ethyl (2R)-2-[[3-chloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (2R)-2-[[3-chloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 59901914 |
| Molecular Formula | C23H29ClN2O5 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | ethyl (2R)-2-[[3-chloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccc(OCCCCNC)c(Cl)c1O |
| InChI | InChI=1S/C23H29ClN2O5/c1-3-30-23(29)18(15-16-9-5-4-6-10-16)26-22(28)17-11-12-19(20(24)21(17)27)31-14-8-7-13-25-2/h4-6,9-12,18,25,27H,3,7-8,13-15H2,1-2H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | VQYBOUKCYACNRW-GOSISDBHSA-N |
| XLogP | 3.33 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|