C29H41Cl2N3O5 — CID 59932458
2-[di(propan-2-yl)amino]ethyl (2S)-2-[[3,5-dichloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoate (PubChem CID 59932458) has the molecular formula C29H41Cl2N3O5 and a molecular weight of 582.57 g/mol. Its IUPAC name is 2-[di(propan-2-yl)amino]ethyl (2S)-2-[[3,5-dichloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoate.
| Compound Name | 2-[di(propan-2-yl)amino]ethyl (2S)-2-[[3,5-dichloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 59932458 |
| Molecular Formula | C29H41Cl2N3O5 |
| Molecular Weight | 582.57 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 2-[di(propan-2-yl)amino]ethyl (2S)-2-[[3,5-dichloro-2-hydroxy-4-[4-(methylamino)butoxy]benzoyl]amino]-3-phenylpropanoate |
| SMILES | CNCCCCOc1c(Cl)cc(C(=O)N[C@@H](Cc2ccccc2)C(=O)OCCN(C(C)C)C(C)C)c(O)c1Cl |
| InChI | InChI=1S/C29H41Cl2N3O5/c1-19(2)34(20(3)4)14-16-39-29(37)24(17-21-11-7-6-8-12-21)33-28(36)22-18-23(30)27(25(31)26(22)35)38-15-10-9-13-32-5/h6-8,11-12,18-20,24,32,35H,9-10,13-17H2,1-5H3,(H,33,36)/t24-/m0/s1 |
| InChIKey | HVRINOWYRPCKRR-DEOSSOPVSA-N |
| XLogP | 5.08 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|