C23H28Cl2N2O5 — CID 58647163
methyl (2S)-2-[[3,5-dichloro-4-[4-(ethylamino)butoxy]-2-hydroxybenzoyl]amino]-3-phenylpropanoate (PubChem CID 58647163) has the molecular formula C23H28Cl2N2O5 and a molecular weight of 483.39 g/mol. Its IUPAC name is methyl (2S)-2-[[3,5-dichloro-4-[4-(ethylamino)butoxy]-2-hydroxybenzoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[3,5-dichloro-4-[4-(ethylamino)butoxy]-2-hydroxybenzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 58647163 |
| Molecular Formula | C23H28Cl2N2O5 |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | methyl (2S)-2-[[3,5-dichloro-4-[4-(ethylamino)butoxy]-2-hydroxybenzoyl]amino]-3-phenylpropanoate |
| SMILES | CCNCCCCOc1c(Cl)cc(C(=O)N[C@@H](Cc2ccccc2)C(=O)OC)c(O)c1Cl |
| InChI | InChI=1S/C23H28Cl2N2O5/c1-3-26-11-7-8-12-32-21-17(24)14-16(20(28)19(21)25)22(29)27-18(23(30)31-2)13-15-9-5-4-6-10-15/h4-6,9-10,14,18,26,28H,3,7-8,11-13H2,1-2H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | QFFCNSXEQUWYML-SFHVURJKSA-N |
| XLogP | 3.98 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|