C23H29Cl3N2O4 — CID 87990003
methyl (2S)-2-[[3,5-dichloro-2-hydroxy-4-[5-(methylamino)pentyl]benzoyl]amino]-3-phenylpropanoate;hydrochloride (PubChem CID 87990003) has the molecular formula C23H29Cl3N2O4 and a molecular weight of 503.85 g/mol. Its IUPAC name is methyl (2S)-2-[[3,5-dichloro-2-hydroxy-4-[5-(methylamino)pentyl]benzoyl]amino]-3-phenylpropanoate;hydrochloride.
| Compound Name | methyl (2S)-2-[[3,5-dichloro-2-hydroxy-4-[5-(methylamino)pentyl]benzoyl]amino]-3-phenylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 87990003 |
| Molecular Formula | C23H29Cl3N2O4 |
| Molecular Weight | 503.85 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | methyl (2S)-2-[[3,5-dichloro-2-hydroxy-4-[5-(methylamino)pentyl]benzoyl]amino]-3-phenylpropanoate;hydrochloride |
| SMILES | CNCCCCCc1c(Cl)cc(C(=O)N[C@@H](Cc2ccccc2)C(=O)OC)c(O)c1Cl.Cl |
| InChI | InChI=1S/C23H28Cl2N2O4.ClH/c1-26-12-8-4-7-11-16-18(24)14-17(21(28)20(16)25)22(29)27-19(23(30)31-2)13-15-9-5-3-6-10-15;/h3,5-6,9-10,14,19,26,28H,4,7-8,11-13H2,1-2H3,(H,27,29);1H/t19-;/m0./s1 |
| InChIKey | LAPRSCQQPXSEBA-FYZYNONXSA-N |
| XLogP | 4.57 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.85 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|