C25H32N2O5 — CID 22094894
methyl 2-[[5-acetyl-2-hydroxy-4-[5-(methylamino)pentyl]benzoyl]amino]-3-phenylpropanoate (PubChem CID 22094894) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is methyl 2-[[5-acetyl-2-hydroxy-4-[5-(methylamino)pentyl]benzoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[5-acetyl-2-hydroxy-4-[5-(methylamino)pentyl]benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 22094894 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | methyl 2-[[5-acetyl-2-hydroxy-4-[5-(methylamino)pentyl]benzoyl]amino]-3-phenylpropanoate |
| SMILES | CNCCCCCc1cc(O)c(C(=O)NC(Cc2ccccc2)C(=O)OC)cc1C(C)=O |
| InChI | InChI=1S/C25H32N2O5/c1-17(28)20-16-21(23(29)15-19(20)12-8-5-9-13-26-2)24(30)27-22(25(31)32-3)14-18-10-6-4-7-11-18/h4,6-7,10-11,15-16,22,26,29H,5,8-9,12-14H2,1-3H3,(H,27,30) |
| InChIKey | KQGDLFQBEGCCEB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|