C23H21Cl2NO2 — CID 70988226
3,4-dichloro-N-[(2S)-1-(4-phenylmethoxyphenyl)propan-2-yl]benzamide (PubChem CID 70988226) has the molecular formula C23H21Cl2NO2 and a molecular weight of 414.33 g/mol. Its IUPAC name is 3,4-dichloro-N-[(2S)-1-(4-phenylmethoxyphenyl)propan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[(2S)-1-(4-phenylmethoxyphenyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 70988226 |
| Molecular Formula | C23H21Cl2NO2 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 3,4-dichloro-N-[(2S)-1-(4-phenylmethoxyphenyl)propan-2-yl]benzamide |
| SMILES | C[C@@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H21Cl2NO2/c1-16(26-23(27)19-9-12-21(24)22(25)14-19)13-17-7-10-20(11-8-17)28-15-18-5-3-2-4-6-18/h2-12,14,16H,13,15H2,1H3,(H,26,27)/t16-/m0/s1 |
| InChIKey | JMXGVNVWFFLWIK-INIZCTEOSA-N |
| XLogP | 5.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |