C18H21NO3 — CID 2843229
3,4-dimethoxy-N-(1-phenylpropan-2-yl)benzamide (PubChem CID 2843229) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(1-phenylpropan-2-yl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(1-phenylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 2843229 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 3,4-dimethoxy-N-(1-phenylpropan-2-yl)benzamide |
| SMILES | COc1ccc(C(=O)NC(C)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C18H21NO3/c1-13(11-14-7-5-4-6-8-14)19-18(20)15-9-10-16(21-2)17(12-15)22-3/h4-10,12-13H,11H2,1-3H3,(H,19,20) |
| InChIKey | OVZUHQFHUIWDGD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |