C18H19Cl3N2O3 — CID 1350071
N-[(1S)-1-(benzylamino)-2,2,2-trichloroethyl]-3,4-dimethoxybenzamide (PubChem CID 1350071) has the molecular formula C18H19Cl3N2O3 and a molecular weight of 417.72 g/mol. Its IUPAC name is N-[(1S)-1-(benzylamino)-2,2,2-trichloroethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(1S)-1-(benzylamino)-2,2,2-trichloroethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 1350071 |
| Molecular Formula | C18H19Cl3N2O3 |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | N-[(1S)-1-(benzylamino)-2,2,2-trichloroethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H](NCc2ccccc2)C(Cl)(Cl)Cl)cc1OC |
| InChI | InChI=1S/C18H19Cl3N2O3/c1-25-14-9-8-13(10-15(14)26-2)16(24)23-17(18(19,20)21)22-11-12-6-4-3-5-7-12/h3-10,17,22H,11H2,1-2H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | BLJDTJAITLSMEC-KRWDZBQOSA-N |
| XLogP | 3.92 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|