C16H16Cl3N3O3 — CID 1321917
3,4-dimethoxy-N-[(1S)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]benzamide (PubChem CID 1321917) has the molecular formula C16H16Cl3N3O3 and a molecular weight of 404.68 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(1S)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[(1S)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 1321917 |
| Molecular Formula | C16H16Cl3N3O3 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 3,4-dimethoxy-N-[(1S)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@H](Nc2ccccn2)C(Cl)(Cl)Cl)cc1OC |
| InChI | InChI=1S/C16H16Cl3N3O3/c1-24-11-7-6-10(9-12(11)25-2)14(23)22-15(16(17,18)19)21-13-5-3-4-8-20-13/h3-9,15H,1-2H3,(H,20,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | ZCLXNAVYGNNYNP-HNNXBMFYSA-N |
| XLogP | 3.64 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|