C15H14Cl3N3O — CID 30467509
4-methyl-N-[(1R)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]benzamide (PubChem CID 30467509) has the molecular formula C15H14Cl3N3O and a molecular weight of 358.66 g/mol. Its IUPAC name is 4-methyl-N-[(1R)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]benzamide.
| Compound Name | 4-methyl-N-[(1R)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 30467509 |
| Molecular Formula | C15H14Cl3N3O |
| Molecular Weight | 358.66 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 4-methyl-N-[(1R)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](Nc2ccccn2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C15H14Cl3N3O/c1-10-5-7-11(8-6-10)13(22)21-14(15(16,17)18)20-12-4-2-3-9-19-12/h2-9,14H,1H3,(H,19,20)(H,21,22)/t14-/m1/s1 |
| InChIKey | PLGBNSMPCMPSLD-CQSZACIVSA-N |
| XLogP | 3.93 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|