C16H16Cl3N3O — CID 1106857
N-[(1S)-2,2,2-trichloro-1-(2,5-dimethylanilino)ethyl]pyridine-2-carboxamide (PubChem CID 1106857) has the molecular formula C16H16Cl3N3O and a molecular weight of 372.68 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(2,5-dimethylanilino)ethyl]pyridine-2-carboxamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(2,5-dimethylanilino)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 1106857 |
| Molecular Formula | C16H16Cl3N3O |
| Molecular Weight | 372.68 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(2,5-dimethylanilino)ethyl]pyridine-2-carboxamide |
| SMILES | Cc1ccc(C)c(N[C@@H](NC(=O)c2ccccn2)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C16H16Cl3N3O/c1-10-6-7-11(2)13(9-10)21-15(16(17,18)19)22-14(23)12-5-3-4-8-20-12/h3-9,15,21H,1-2H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | DMFDIJMJNLKKBU-HNNXBMFYSA-N |
| XLogP | 4.24 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|