C15H14Cl3N3O2 — CID 1106851
N-[(1S)-2,2,2-trichloro-1-(2-methoxyanilino)ethyl]pyridine-2-carboxamide (PubChem CID 1106851) has the molecular formula C15H14Cl3N3O2 and a molecular weight of 374.66 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(2-methoxyanilino)ethyl]pyridine-2-carboxamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(2-methoxyanilino)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 1106851 |
| Molecular Formula | C15H14Cl3N3O2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(2-methoxyanilino)ethyl]pyridine-2-carboxamide |
| SMILES | COc1ccccc1N[C@@H](NC(=O)c1ccccn1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H14Cl3N3O2/c1-23-12-8-3-2-6-10(12)20-14(15(16,17)18)21-13(22)11-7-4-5-9-19-11/h2-9,14,20H,1H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | TYIFLICXKFAKRB-AWEZNQCLSA-N |
| XLogP | 3.63 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|