C14H19Cl3N2O2 — CID 2302469
3-methyl-N-[(1S)-2,2,2-trichloro-1-(2-methoxyanilino)ethyl]butanamide (PubChem CID 2302469) has the molecular formula C14H19Cl3N2O2 and a molecular weight of 353.68 g/mol. Its IUPAC name is 3-methyl-N-[(1S)-2,2,2-trichloro-1-(2-methoxyanilino)ethyl]butanamide.
| Compound Name | 3-methyl-N-[(1S)-2,2,2-trichloro-1-(2-methoxyanilino)ethyl]butanamide |
|---|---|
| PubChem CID | 2302469 |
| Molecular Formula | C14H19Cl3N2O2 |
| Molecular Weight | 353.68 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 3-methyl-N-[(1S)-2,2,2-trichloro-1-(2-methoxyanilino)ethyl]butanamide |
| SMILES | COc1ccccc1N[C@@H](NC(=O)CC(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H19Cl3N2O2/c1-9(2)8-12(20)19-13(14(15,16)17)18-10-6-4-5-7-11(10)21-3/h4-7,9,13,18H,8H2,1-3H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | ZBRXKDKDYALUCY-ZDUSSCGKSA-N |
| XLogP | 3.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.68 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|