C13H16Cl3IN2O — CID 2302487
3-methyl-N-[(1S)-2,2,2-trichloro-1-(2-iodoanilino)ethyl]butanamide (PubChem CID 2302487) has the molecular formula C13H16Cl3IN2O and a molecular weight of 449.55 g/mol. Its IUPAC name is 3-methyl-N-[(1S)-2,2,2-trichloro-1-(2-iodoanilino)ethyl]butanamide.
| Compound Name | 3-methyl-N-[(1S)-2,2,2-trichloro-1-(2-iodoanilino)ethyl]butanamide |
|---|---|
| PubChem CID | 2302487 |
| Molecular Formula | C13H16Cl3IN2O |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 447.94 |
| IUPAC Name | 3-methyl-N-[(1S)-2,2,2-trichloro-1-(2-iodoanilino)ethyl]butanamide |
| SMILES | CC(C)CC(=O)N[C@H](Nc1ccccc1I)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H16Cl3IN2O/c1-8(2)7-11(20)19-12(13(14,15)16)18-10-6-4-3-5-9(10)17/h3-6,8,12,18H,7H2,1-2H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | ANSWTUWRQCMHCO-LBPRGKRZSA-N |
| XLogP | 4.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|