C13H15Cl5N2O — CID 4581510
3-methyl-N-[2,2,2-trichloro-1-(2,6-dichloroanilino)ethyl]butanamide (PubChem CID 4581510) has the molecular formula C13H15Cl5N2O and a molecular weight of 392.54 g/mol. Its IUPAC name is 3-methyl-N-[2,2,2-trichloro-1-(2,6-dichloroanilino)ethyl]butanamide.
| Compound Name | 3-methyl-N-[2,2,2-trichloro-1-(2,6-dichloroanilino)ethyl]butanamide |
|---|---|
| PubChem CID | 4581510 |
| Molecular Formula | C13H15Cl5N2O |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 3-methyl-N-[2,2,2-trichloro-1-(2,6-dichloroanilino)ethyl]butanamide |
| SMILES | CC(C)CC(=O)NC(Nc1c(Cl)cccc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H15Cl5N2O/c1-7(2)6-10(21)19-12(13(16,17)18)20-11-8(14)4-3-5-9(11)15/h3-5,7,12,20H,6H2,1-2H3,(H,19,21) |
| InChIKey | IVVHHQMBVRFMOJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|