C11H13Cl2NO — CID 849070
N-(2,6-dichlorophenyl)-3-methylbutanamide (PubChem CID 849070) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-3-methylbutanamide.
| Compound Name | N-(2,6-dichlorophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 849070 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | N-(2,6-dichlorophenyl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H13Cl2NO/c1-7(2)6-10(15)14-11-8(12)4-3-5-9(11)13/h3-5,7H,6H2,1-2H3,(H,14,15) |
| InChIKey | KWJOXCWVGQOQQI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |