C8H7Cl2NOS — CID 14567957
N-(2,6-dichlorophenyl)-2-sulfanylacetamide (PubChem CID 14567957) has the molecular formula C8H7Cl2NOS and a molecular weight of 236.12 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-sulfanylacetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 14567957 |
| Molecular Formula | C8H7Cl2NOS |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 234.96 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-sulfanylacetamide |
| SMILES | O=C(CS)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H7Cl2NOS/c9-5-2-1-3-6(10)8(5)11-7(12)4-13/h1-3,13H,4H2,(H,11,12) |
| InChIKey | HJMIYGDIKLUAGA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|