C17H14Cl4N2O2 — CID 1291740
N,N'-bis(2,6-dichlorophenyl)pentanediamide (PubChem CID 1291740) has the molecular formula C17H14Cl4N2O2 and a molecular weight of 420.12 g/mol. Its IUPAC name is N,N'-bis(2,6-dichlorophenyl)pentanediamide.
| Compound Name | N,N'-bis(2,6-dichlorophenyl)pentanediamide |
|---|---|
| PubChem CID | 1291740 |
| Molecular Formula | C17H14Cl4N2O2 |
| Molecular Weight | 420.12 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | N,N'-bis(2,6-dichlorophenyl)pentanediamide |
| SMILES | O=C(CCCC(=O)Nc1c(Cl)cccc1Cl)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H14Cl4N2O2/c18-10-4-1-5-11(19)16(10)22-14(24)8-3-9-15(25)23-17-12(20)6-2-7-13(17)21/h1-2,4-7H,3,8-9H2,(H,22,24)(H,23,25) |
| InChIKey | KFNAHLPPZJNBFZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.12 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |