C16H15Cl3N2O — CID 109021615
3-[(2-chlorophenyl)methylamino]-N-(2,6-dichlorophenyl)propanamide (PubChem CID 109021615) has the molecular formula C16H15Cl3N2O and a molecular weight of 357.67 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methylamino]-N-(2,6-dichlorophenyl)propanamide.
| Compound Name | 3-[(2-chlorophenyl)methylamino]-N-(2,6-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 109021615 |
| Molecular Formula | C16H15Cl3N2O |
| Molecular Weight | 357.67 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 3-[(2-chlorophenyl)methylamino]-N-(2,6-dichlorophenyl)propanamide |
| SMILES | O=C(CCNCc1ccccc1Cl)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H15Cl3N2O/c17-12-5-2-1-4-11(12)10-20-9-8-15(22)21-16-13(18)6-3-7-14(16)19/h1-7,20H,8-10H2,(H,21,22) |
| InChIKey | YKAWTVSLCGKZEM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.67 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|