C16H23Cl2NO — CID 3269237
N-(2,6-dichlorophenyl)decanamide (PubChem CID 3269237) has the molecular formula C16H23Cl2NO and a molecular weight of 316.27 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)decanamide.
| Compound Name | N-(2,6-dichlorophenyl)decanamide |
|---|---|
| PubChem CID | 3269237 |
| Molecular Formula | C16H23Cl2NO |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-(2,6-dichlorophenyl)decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H23Cl2NO/c1-2-3-4-5-6-7-8-12-15(20)19-16-13(17)10-9-11-14(16)18/h9-11H,2-8,12H2,1H3,(H,19,20) |
| InChIKey | GYSAKLGEKBZVPQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|