C23H28Cl2N2O2 — CID 46501979
4-(decanoylamino)-N-(2,6-dichlorophenyl)benzamide (PubChem CID 46501979) has the molecular formula C23H28Cl2N2O2 and a molecular weight of 435.40 g/mol. Its IUPAC name is 4-(decanoylamino)-N-(2,6-dichlorophenyl)benzamide.
| Compound Name | 4-(decanoylamino)-N-(2,6-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 46501979 |
| Molecular Formula | C23H28Cl2N2O2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 4-(decanoylamino)-N-(2,6-dichlorophenyl)benzamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(C(=O)Nc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C23H28Cl2N2O2/c1-2-3-4-5-6-7-8-12-21(28)26-18-15-13-17(14-16-18)23(29)27-22-19(24)10-9-11-20(22)25/h9-11,13-16H,2-8,12H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | JJYFJZQCMBXZID-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|