C12H14Cl2N2O2 — CID 113001397
N-[2-(2,6-dichloroanilino)-2-oxoethyl]butanamide (PubChem CID 113001397) has the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.16 g/mol. Its IUPAC name is N-[2-(2,6-dichloroanilino)-2-oxoethyl]butanamide.
| Compound Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 113001397 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]butanamide |
| SMILES | CCCC(=O)NCC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O2/c1-2-4-10(17)15-7-11(18)16-12-8(13)5-3-6-9(12)14/h3,5-6H,2,4,7H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | PCJQOCJMTCEDOZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |