C10H10Cl2N2O3 — CID 113001448
methyl N-[2-(2,6-dichloroanilino)-2-oxoethyl]carbamate (PubChem CID 113001448) has the molecular formula C10H10Cl2N2O3 and a molecular weight of 277.11 g/mol. Its IUPAC name is methyl N-[2-(2,6-dichloroanilino)-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-(2,6-dichloroanilino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 113001448 |
| Molecular Formula | C10H10Cl2N2O3 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | methyl N-[2-(2,6-dichloroanilino)-2-oxoethyl]carbamate |
| SMILES | COC(=O)NCC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H10Cl2N2O3/c1-17-10(16)13-5-8(15)14-9-6(11)3-2-4-7(9)12/h2-4H,5H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | APXVDOOVOPJSJF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |