C15H10Cl4N2O2 — CID 113001415
3,4-dichloro-N-[2-(2,6-dichloroanilino)-2-oxoethyl]benzamide (PubChem CID 113001415) has the molecular formula C15H10Cl4N2O2 and a molecular weight of 392.07 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(2,6-dichloroanilino)-2-oxoethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(2,6-dichloroanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 113001415 |
| Molecular Formula | C15H10Cl4N2O2 |
| Molecular Weight | 392.07 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | 3,4-dichloro-N-[2-(2,6-dichloroanilino)-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H10Cl4N2O2/c16-9-5-4-8(6-12(9)19)15(23)20-7-13(22)21-14-10(17)2-1-3-11(14)18/h1-6H,7H2,(H,20,23)(H,21,22) |
| InChIKey | DIGLIKWBNVRCCY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.07 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |