C19H20Cl2N2O2 — CID 112997392
3,4-dichloro-N-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]benzamide (PubChem CID 112997392) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 112997392 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3,4-dichloro-N-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]benzamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)CNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c1-11(2)14-6-4-5-12(3)18(14)23-17(24)10-22-19(25)13-7-8-15(20)16(21)9-13/h4-9,11H,10H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | QKVYCSMDPXBNTJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |