C17H17ClN2O2 — CID 2679820
4-chloro-N-[2-(2,6-dimethylanilino)-2-oxoethyl]benzamide (PubChem CID 2679820) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is 4-chloro-N-[2-(2,6-dimethylanilino)-2-oxoethyl]benzamide.
| Compound Name | 4-chloro-N-[2-(2,6-dimethylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 2679820 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-chloro-N-[2-(2,6-dimethylanilino)-2-oxoethyl]benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN2O2/c1-11-4-3-5-12(2)16(11)20-15(21)10-19-17(22)13-6-8-14(18)9-7-13/h3-9H,10H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | BBCNUHTYIAYEDY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |