C16H14F2N2O2 — CID 46745022
N-[2-(2,6-difluoroanilino)-2-oxoethyl]-4-methylbenzamide (PubChem CID 46745022) has the molecular formula C16H14F2N2O2 and a molecular weight of 304.30 g/mol. Its IUPAC name is N-[2-(2,6-difluoroanilino)-2-oxoethyl]-4-methylbenzamide.
| Compound Name | N-[2-(2,6-difluoroanilino)-2-oxoethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 46745022 |
| Molecular Formula | C16H14F2N2O2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-[2-(2,6-difluoroanilino)-2-oxoethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C16H14F2N2O2/c1-10-5-7-11(8-6-10)16(22)19-9-14(21)20-15-12(17)3-2-4-13(15)18/h2-8H,9H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | FDWSFKAUBYGZPS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |