C20H24N2O4S — CID 55757965
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-propan-2-ylsulfonylbenzamide (PubChem CID 55757965) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-propan-2-ylsulfonylbenzamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-propan-2-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55757965 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-propan-2-ylsulfonylbenzamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)c1ccc(S(=O)(=O)C(C)C)cc1 |
| InChI | InChI=1S/C20H24N2O4S/c1-13(2)27(25,26)17-10-8-16(9-11-17)20(24)21-12-18(23)22-19-14(3)6-5-7-15(19)4/h5-11,13H,12H2,1-4H3,(H,21,24)(H,22,23) |
| InChIKey | YGCSRHIGRXSJSC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |