C19H22N2O4S — CID 27760143
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 27760143) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 27760143 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H22N2O4S/c1-13-5-4-6-14(2)18(13)21-17(22)11-20-19(23)16-9-7-15(8-10-16)12-26(3,24)25/h4-10H,11-12H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | XXENYWDUXIHHBS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |