C17H16F2N2O4S — CID 17483539
N-[2-(3,4-difluoroanilino)-2-oxoethyl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 17483539) has the molecular formula C17H16F2N2O4S and a molecular weight of 382.39 g/mol. Its IUPAC name is N-[2-(3,4-difluoroanilino)-2-oxoethyl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[2-(3,4-difluoroanilino)-2-oxoethyl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 17483539 |
| Molecular Formula | C17H16F2N2O4S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-[2-(3,4-difluoroanilino)-2-oxoethyl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H16F2N2O4S/c1-26(24,25)10-11-2-4-12(5-3-11)17(23)20-9-16(22)21-13-6-7-14(18)15(19)8-13/h2-8H,9-10H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | LAOLQNZGOPJMNJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |