C18H19FN2O2 — CID 9216095
N-[2-(3-fluoro-4-methylanilino)-2-oxoethyl]-3,4-dimethylbenzamide (PubChem CID 9216095) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is N-[2-(3-fluoro-4-methylanilino)-2-oxoethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-(3-fluoro-4-methylanilino)-2-oxoethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 9216095 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[2-(3-fluoro-4-methylanilino)-2-oxoethyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)Nc2ccc(C)c(F)c2)cc1C |
| InChI | InChI=1S/C18H19FN2O2/c1-11-4-6-14(8-13(11)3)18(23)20-10-17(22)21-15-7-5-12(2)16(19)9-15/h4-9H,10H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | XWFKLKWFMRTBAA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |