C17H19N3O4S — CID 18161684
3,4-dimethyl-N-[2-oxo-2-(4-sulfamoylanilino)ethyl]benzamide (PubChem CID 18161684) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is 3,4-dimethyl-N-[2-oxo-2-(4-sulfamoylanilino)ethyl]benzamide.
| Compound Name | 3,4-dimethyl-N-[2-oxo-2-(4-sulfamoylanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 18161684 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 3,4-dimethyl-N-[2-oxo-2-(4-sulfamoylanilino)ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1C |
| InChI | InChI=1S/C17H19N3O4S/c1-11-3-4-13(9-12(11)2)17(22)19-10-16(21)20-14-5-7-15(8-6-14)25(18,23)24/h3-9H,10H2,1-2H3,(H,19,22)(H,20,21)(H2,18,23,24) |
| InChIKey | IMGDLVRATCZTSQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |