C19H19IN2O4 — CID 2477229
[2-(4-iodoanilino)-2-oxoethyl] 2-[(3,4-dimethylbenzoyl)amino]acetate (PubChem CID 2477229) has the molecular formula C19H19IN2O4 and a molecular weight of 466.28 g/mol. Its IUPAC name is [2-(4-iodoanilino)-2-oxoethyl] 2-[(3,4-dimethylbenzoyl)amino]acetate.
| Compound Name | [2-(4-iodoanilino)-2-oxoethyl] 2-[(3,4-dimethylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2477229 |
| Molecular Formula | C19H19IN2O4 |
| Molecular Weight | 466.28 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | [2-(4-iodoanilino)-2-oxoethyl] 2-[(3,4-dimethylbenzoyl)amino]acetate |
| SMILES | Cc1ccc(C(=O)NCC(=O)OCC(=O)Nc2ccc(I)cc2)cc1C |
| InChI | InChI=1S/C19H19IN2O4/c1-12-3-4-14(9-13(12)2)19(25)21-10-18(24)26-11-17(23)22-16-7-5-15(20)6-8-16/h3-9H,10-11H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | YGTFATCSOBBMLX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|