C17H14ClIN2O4 — CID 2488185
[2-(4-iodoanilino)-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate (PubChem CID 2488185) has the molecular formula C17H14ClIN2O4 and a molecular weight of 472.67 g/mol. Its IUPAC name is [2-(4-iodoanilino)-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate.
| Compound Name | [2-(4-iodoanilino)-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2488185 |
| Molecular Formula | C17H14ClIN2O4 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | [2-(4-iodoanilino)-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc(Cl)cc1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C17H14ClIN2O4/c18-12-3-1-11(2-4-12)17(24)20-9-16(23)25-10-15(22)21-14-7-5-13(19)6-8-14/h1-8H,9-10H2,(H,20,24)(H,21,22) |
| InChIKey | LBIGUDGMRLXXMQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|