C15H9F5N2O2 — CID 113002351
N-[2-(3,4-difluoroanilino)-2-oxoethyl]-2,3,4-trifluorobenzamide (PubChem CID 113002351) has the molecular formula C15H9F5N2O2 and a molecular weight of 344.24 g/mol. Its IUPAC name is N-[2-(3,4-difluoroanilino)-2-oxoethyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[2-(3,4-difluoroanilino)-2-oxoethyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 113002351 |
| Molecular Formula | C15H9F5N2O2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-[2-(3,4-difluoroanilino)-2-oxoethyl]-2,3,4-trifluorobenzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)c(F)c1F)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H9F5N2O2/c16-9-3-1-7(5-11(9)18)22-12(23)6-21-15(24)8-2-4-10(17)14(20)13(8)19/h1-5H,6H2,(H,21,24)(H,22,23) |
| InChIKey | JSHQTMFXIAKFEL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|