C13H7F4NO — CID 62648495
N-(3,4-difluorophenyl)-2,3-difluorobenzamide (PubChem CID 62648495) has the molecular formula C13H7F4NO and a molecular weight of 269.20 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2,3-difluorobenzamide.
| Compound Name | N-(3,4-difluorophenyl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 62648495 |
| Molecular Formula | C13H7F4NO |
| Molecular Weight | 269.20 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | N-(3,4-difluorophenyl)-2,3-difluorobenzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1cccc(F)c1F |
| InChI | InChI=1S/C13H7F4NO/c14-9-5-4-7(6-11(9)16)18-13(19)8-2-1-3-10(15)12(8)17/h1-6H,(H,18,19) |
| InChIKey | LPZGGCLYZAPYAP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.20 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |