C13H7Cl2F2NO — CID 62650988
N-(3,5-dichlorophenyl)-2,3-difluorobenzamide (PubChem CID 62650988) has the molecular formula C13H7Cl2F2NO and a molecular weight of 302.11 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2,3-difluorobenzamide.
| Compound Name | N-(3,5-dichlorophenyl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 62650988 |
| Molecular Formula | C13H7Cl2F2NO |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2,3-difluorobenzamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1cccc(F)c1F |
| InChI | InChI=1S/C13H7Cl2F2NO/c14-7-4-8(15)6-9(5-7)18-13(19)10-2-1-3-11(16)12(10)17/h1-6H,(H,18,19) |
| InChIKey | KWZNCCNUSPLILJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |