C17H10Cl3NO — CID 17102050
5-chloro-N-(3,5-dichlorophenyl)naphthalene-1-carboxamide (PubChem CID 17102050) has the molecular formula C17H10Cl3NO and a molecular weight of 350.63 g/mol. Its IUPAC name is 5-chloro-N-(3,5-dichlorophenyl)naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-(3,5-dichlorophenyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 17102050 |
| Molecular Formula | C17H10Cl3NO |
| Molecular Weight | 350.63 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 5-chloro-N-(3,5-dichlorophenyl)naphthalene-1-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1cccc2c(Cl)cccc12 |
| InChI | InChI=1S/C17H10Cl3NO/c18-10-7-11(19)9-12(8-10)21-17(22)15-5-1-4-14-13(15)3-2-6-16(14)20/h1-9H,(H,21,22) |
| InChIKey | GWOKSXPKBBISGT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |