C18H11Cl3N2OS — CID 22775522
5-chloro-N-[(2,5-dichlorophenyl)carbamothioyl]naphthalene-1-carboxamide (PubChem CID 22775522) has the molecular formula C18H11Cl3N2OS and a molecular weight of 409.73 g/mol. Its IUPAC name is 5-chloro-N-[(2,5-dichlorophenyl)carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-[(2,5-dichlorophenyl)carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 22775522 |
| Molecular Formula | C18H11Cl3N2OS |
| Molecular Weight | 409.73 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | 5-chloro-N-[(2,5-dichlorophenyl)carbamothioyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc(Cl)ccc1Cl)c1cccc2c(Cl)cccc12 |
| InChI | InChI=1S/C18H11Cl3N2OS/c19-10-7-8-15(21)16(9-10)22-18(25)23-17(24)13-5-1-4-12-11(13)3-2-6-14(12)20/h1-9H,(H2,22,23,24,25) |
| InChIKey | YZBRZMIDKKYKOR-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.73 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|