C27H19Cl2N3O2S — CID 17315170
5-chloro-N-[[2-chloro-5-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 17315170) has the molecular formula C27H19Cl2N3O2S and a molecular weight of 520.44 g/mol. Its IUPAC name is 5-chloro-N-[[2-chloro-5-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-[[2-chloro-5-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 17315170 |
| Molecular Formula | C27H19Cl2N3O2S |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | 5-chloro-N-[[2-chloro-5-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | CCc1ccc2oc(-c3ccc(Cl)c(NC(=S)NC(=O)c4cccc5c(Cl)cccc45)c3)nc2c1 |
| InChI | InChI=1S/C27H19Cl2N3O2S/c1-2-15-9-12-24-23(13-15)30-26(34-24)16-10-11-21(29)22(14-16)31-27(35)32-25(33)19-7-3-6-18-17(19)5-4-8-20(18)28/h3-14H,2H2,1H3,(H2,31,32,33,35) |
| InChIKey | NCGWNWCPCVPIGR-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|