C27H24ClN5O4S — CID 17315216
N-[[2-chloro-5-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 17315216) has the molecular formula C27H24ClN5O4S and a molecular weight of 550.04 g/mol. Its IUPAC name is N-[[2-chloro-5-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[[2-chloro-5-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17315216 |
| Molecular Formula | C27H24ClN5O4S |
| Molecular Weight | 550.04 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | N-[[2-chloro-5-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | CCc1ccc2oc(-c3ccc(Cl)c(NC(=S)NC(=O)c4ccc(N5CCCC5)c([N+](=O)[O-])c4)c3)nc2c1 |
| InChI | InChI=1S/C27H24ClN5O4S/c1-2-16-5-10-24-21(13-16)29-26(37-24)18-6-8-19(28)20(14-18)30-27(38)31-25(34)17-7-9-22(23(15-17)33(35)36)32-11-3-4-12-32/h5-10,13-15H,2-4,11-12H2,1H3,(H2,30,31,34,38) |
| InChIKey | VFXXKAMZGKDLMU-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.04 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|