C26H22ClN5O4S — CID 17315211
N-[[4-chloro-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 17315211) has the molecular formula C26H22ClN5O4S and a molecular weight of 536.01 g/mol. Its IUPAC name is N-[[4-chloro-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[[4-chloro-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17315211 |
| Molecular Formula | C26H22ClN5O4S |
| Molecular Weight | 536.01 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | N-[[4-chloro-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | Cc1ccc2oc(-c3cc(NC(=S)NC(=O)c4ccc(N5CCCC5)c([N+](=O)[O-])c4)ccc3Cl)nc2c1 |
| InChI | InChI=1S/C26H22ClN5O4S/c1-15-4-9-23-20(12-15)29-25(36-23)18-14-17(6-7-19(18)27)28-26(37)30-24(33)16-5-8-21(22(13-16)32(34)35)31-10-2-3-11-31/h4-9,12-14H,2-3,10-11H2,1H3,(H2,28,30,33,37) |
| InChIKey | HMENEMOGPVUEIG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.01 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|