C25H21ClN4O4 — CID 17117215
N-[2-(2-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 17117215) has the molecular formula C25H21ClN4O4 and a molecular weight of 476.92 g/mol. Its IUPAC name is N-[2-(2-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[2-(2-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17117215 |
| Molecular Formula | C25H21ClN4O4 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-[2-(2-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | Cc1ccc(-c2nc3cc(NC(=O)c4ccc(N5CCCC5)c([N+](=O)[O-])c4)ccc3o2)c(Cl)c1 |
| InChI | InChI=1S/C25H21ClN4O4/c1-15-4-7-18(19(26)12-15)25-28-20-14-17(6-9-23(20)34-25)27-24(31)16-5-8-21(22(13-16)30(32)33)29-10-2-3-11-29/h4-9,12-14H,2-3,10-11H2,1H3,(H,27,31) |
| InChIKey | JFPZBPHRFZLOOP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|