C26H23N5O5S — CID 137118481
N-[[4-(1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 137118481) has the molecular formula C26H23N5O5S and a molecular weight of 517.57 g/mol. Its IUPAC name is N-[[4-(1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[[4-(1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 137118481 |
| Molecular Formula | C26H23N5O5S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | N-[[4-(1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(-c2nc3ccccc3o2)c(O)c1)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H23N5O5S/c32-22-15-17(9-10-18(22)25-28-19-6-2-3-7-23(19)36-25)27-26(37)29-24(33)16-8-11-20(21(14-16)31(34)35)30-12-4-1-5-13-30/h2-3,6-11,14-15,32H,1,4-5,12-13H2,(H2,27,29,33,37) |
| InChIKey | YCORTBRESLNLHW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|