C26H23N5O4S — CID 17114927
N-[[4-(1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 17114927) has the molecular formula C26H23N5O4S and a molecular weight of 501.57 g/mol. Its IUPAC name is N-[[4-(1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17114927 |
| Molecular Formula | C26H23N5O4S |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NC(=S)NCc1ccc(-c2nc3ccccc3o2)cc1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H23N5O4S/c32-24(19-11-12-21(22(15-19)31(33)34)30-13-3-4-14-30)29-26(36)27-16-17-7-9-18(10-8-17)25-28-20-5-1-2-6-23(20)35-25/h1-2,5-12,15H,3-4,13-14,16H2,(H2,27,29,32,36) |
| InChIKey | VCECQGJLUAVLKL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|