C29H29N5O5S — CID 17314891
4-morpholin-4-yl-3-nitro-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]benzamide (PubChem CID 17314891) has the molecular formula C29H29N5O5S and a molecular weight of 559.65 g/mol. Its IUPAC name is 4-morpholin-4-yl-3-nitro-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]benzamide.
| Compound Name | 4-morpholin-4-yl-3-nitro-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]benzamide |
|---|---|
| PubChem CID | 17314891 |
| Molecular Formula | C29H29N5O5S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 4-morpholin-4-yl-3-nitro-N-[[4-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]methylcarbamothioyl]benzamide |
| SMILES | CC(C)c1ccc2oc(-c3ccc(CNC(=S)NC(=O)c4ccc(N5CCOCC5)c([N+](=O)[O-])c4)cc3)nc2c1 |
| InChI | InChI=1S/C29H29N5O5S/c1-18(2)21-8-10-26-23(15-21)31-28(39-26)20-5-3-19(4-6-20)17-30-29(40)32-27(35)22-7-9-24(25(16-22)34(36)37)33-11-13-38-14-12-33/h3-10,15-16,18H,11-14,17H2,1-2H3,(H2,30,32,35,40) |
| InChIKey | KYHNMWVPTGZAOM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|