C20H20N4O6S — CID 28688208
4-[[(4-morpholin-4-yl-3-nitrobenzoyl)carbamothioylamino]methyl]benzoic acid (PubChem CID 28688208) has the molecular formula C20H20N4O6S and a molecular weight of 444.47 g/mol. Its IUPAC name is 4-[[(4-morpholin-4-yl-3-nitrobenzoyl)carbamothioylamino]methyl]benzoic acid.
| Compound Name | 4-[[(4-morpholin-4-yl-3-nitrobenzoyl)carbamothioylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 28688208 |
| Molecular Formula | C20H20N4O6S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 4-[[(4-morpholin-4-yl-3-nitrobenzoyl)carbamothioylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=S)NC(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H20N4O6S/c25-18(22-20(31)21-12-13-1-3-14(4-2-13)19(26)27)15-5-6-16(17(11-15)24(28)29)23-7-9-30-10-8-23/h1-6,11H,7-10,12H2,(H,26,27)(H2,21,22,25,31) |
| InChIKey | HWUPVGDJILASDC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|