C23H22N8O4S2 — CID 17314896
N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17314896) has the molecular formula C23H22N8O4S2 and a molecular weight of 538.62 g/mol. Its IUPAC name is N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17314896 |
| Molecular Formula | C23H22N8O4S2 |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | N-[[4-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]methylcarbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | Cc1nnc2sc(-c3ccc(CNC(=S)NC(=O)c4ccc(N5CCOCC5)c([N+](=O)[O-])c4)cc3)nn12 |
| InChI | InChI=1S/C23H22N8O4S2/c1-14-26-27-23-30(14)28-21(37-23)16-4-2-15(3-5-16)13-24-22(36)25-20(32)17-6-7-18(19(12-17)31(33)34)29-8-10-35-11-9-29/h2-7,12H,8-11,13H2,1H3,(H2,24,25,32,36) |
| InChIKey | VGCOUGAKANSJED-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|